Product Name: STA-21
Synonyms: (3S)-3,4-dihydro-8-hydroxy-3-methyl-benz[a]anthracene-1,7,12(2H)-trione OchromycinoneMedchemexpress.com
Product Overview: Potently inhibits STAT3 by preventing its dimerization and DNA binding at concentrations of 20-30 μM; blocks the growth and survival of cancer cells that express constitutively active Stat3 (e.g., DU145 cells, IC50 = 12.2 μM); prevents the prolifera
Shipping: wet ice
CAS NO: 500992-11-0 Product: Tat-NR2B9c
Stability: Store at -20 degrees; shelf life 730 days maximum after production
Molecular Formula: C19H14O4
SMILES: O=C1C2=C(C=CC(C[C@H](C)C3)=C2C3=O)C(C4=C(O)C=CC=C41)=OPhenols inhibitors
Molecular Weight: 306.3
Formulation: A crystalline solid
Purity: ≥98%PubMed ID:http://aac.asm.org/content/55/6/3036.abstract