Product Name: NMDA
Synonyms: N-methyl-D-aspartic acid N-Methyl-D-Aspartic AcidWeb Site:Medchemexpress
Product Overview: A synthetic amino acid derivative that acts as a specific agonist at the NMDA receptor, mimicking the excitatory action of the endogenous ligand glutamateNMDA is a synthetic amino acid derivative that acts as a specific agonist at the NMDA receptor, mimic
Shipping: wet ice
CAS NO: 266359-83-5 Reparixin
Stability: Store at -20 degrees; shelf life 730 days maximum after production
Molecular Formula: C5H9NO4
SMILES: OC([C@H](NC)CC(O)=O)=ONeuronal Signaling inhibitors
Molecular Weight: 147.1
Formulation: A crystalline solid
Purity: ≥98%PubMed ID:http://www.bloodjournal.org/content/129/11/1411