Product Name: Letermovir
Synonyms: (4S)-8-fluoro-3,4-dihydro-2-[4-(3-methoxyphenyl)-1-piperazinyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4-quinazolineacetic acid AIC246Medchemexpress
Product Overview: A small molecule inhibitor of human cytomegalovirus viral replication (EC50 = ~5 nM with a selectivity index >15,000) that targets viral DNA cleavage and packagingLetermovir is a small molecule inhibitor of human cytomegalovirus viral replicatio
Shipping: wet ice
CAS NO: 62956-48-3 Product: Gomisin G
Stability: Store at -20 degrees; shelf life 730 days maximum after production
Molecular Formula: C29H28F4N4O4
SMILES: OC(C[C@H]1C2=CC=CC(F)=C2N=C(N3CCN(C4=CC(OC)=CC=C4)CC3)N1C5=C(OC)C=CC(C(F)(F)F)=C5)=OSTAT inhibitors
Molecular Weight: 572.6
Formulation: A crystalline solid
Purity: ≥98%PubMed ID:http://aac.asm.org/content/57/1/559.abstract