Product Name: BI-6727
Synonyms: N-[trans-4-[4-(cyclopropylmethyl)-1-piperazinyl]cyclohexyl]-4-[[(7R)-7-ethyl-5,6,7,8-tetrahydro-5-methyl-8-(1-methylethyl)-6-oxo-2-pteridinyl]amino]-3-methoxy-benzamide Medchemexpress
Product Overview: A dihydropteridinone that inhibits Plk1, Plk2, and Plk3 (IC50s = 0.87, 5, and 56 nM, respectively), inducing mitotic arrest and apoptosis; inhibits proliferation of multiple cancer cell lines (EC50s = 11-37 nM) and prevents the growth of various human car
Shipping: wet ice
CAS NO: 84504-69-8 Product: Irsogladine (maleate)
Stability: Store at -20 degrees; shelf life 730 days maximum after production
Molecular Formula: C34H50N8O3
SMILES: CC[C@@H]1C(N(C)C2=CN=C(NC3=C(OC)C=C(C(N[C@@H]4CC[C@@H](N5CCN(CC6CC6)CC5)CC4)=O)C=C3)N=C2N1C(C)C)=OIntegrin inhibitors
Molecular Weight: 618.8
Formulation: A crystalline solid
Purity: ≥98%PubMed ID:http://aac.asm.org/content/58/12/7583.abstract